Product Description
Dipropylene Glycol Methyl Ether Acetate
| Product Name | di(propylene glycol) methyl ether acetate |
| Synonyms | Di(propylene glycol) methyl ether acetate,mixture of isomers 1-(3-methoxypropoxy)propyl acetate 3-(3-methoxypropoxy)propyl acetate Dipropylene glycol monomethyl ether acetate |
| CAS No. | 88917-22-0 |
| EINECS | N/A |
| Inchi | InChI=1/C9H18O4/c1-9(10)13-8-4-7-12-6-3-5-11-2/h3-8H2,1-2H3 |
| Short for Name | DPMA |
| Appearance | Clear transparent liquid |
| Purity: | ≥98.5% |
| Physico-chemical Properties | |
| Molecular Formula: | C9H18O4 |
| Molecular | 190.2368 |
| Viscosity | ---- |
| Density | 0.965~0.975 |
| Flash point: | 98.5°C |
| Boiling point | 205-217ºC |
| Melting point | -- |
| Vapour pressure | -- |
| \Water Solubility | miscible ≤0.05% |
| Refractive index | n20/D1.417 |
| Surface tension | -- |
| Freezing Point | -- |
| Type | Syntheses Material Intermediates |
| Packages and Capacity | |
| Nornal pacakge | 200kgs/drum |
| MOQ | 1kg |
| Capactiy | 250MT/year |
| Application | |
| 1.DPMA is a colorless, transparent, low-toxic, flammable liquid with a slight ether odor. It has low viscosity, strong solubility, moderate evaporation rate and good coupling ability. It has good solubility for most resins such as acrylic resin, epoxy resin, alkyd resin and polyester resin. 2.DPMA is well used for inkjet solvents, high-solid coating solvents, solvent-based coatings and screen printing paints, polyurethane coatings, inks, cleaning agents. | |
Hot Tags: dipropylene glycol methyl ether acetate, China, manufacturers, suppliers, factory, cheap, discount, quotation, low price, free sample
